2,5-Диметоксибензальдегид

Арт.: 93027.500

13433 грн.

В наличии

Содержание основного вещества не менее 99%

Квалификация: "Для синтеза"

Производитель: импортный

Арт. 93027

 

Описание:

Название продукта

2,5-Dimethoxybenzaldehyde; 2,5-Диметоксибензальдегид

Синонимы

2,5-Dimethylbenzaldehyde; 2,5-Dimethoxy benzaldehyde; 2,5-Диметокси бензальдегид

Молекулярная формула

C9H10O3

Молекулярный вес

166.18

InChI

InChI=1/C9H10O3/c1-11-8-3-4-9(12-2)7(5-8)6-10/h3-6H,1-2H3

Регистрационный номер CAS

93-02-7

EINECS

202-211-5

Молекулярная структура

Температура плавления*

45-50℃

Точка кипения

146℃ (10 torr)

Символы опасности

 Xi:Irritant;

Риск коды

R36/37/38:;

 

Характеристики безопасности

S24/25:;

 

 

Сообщения не найдены

Загрузка...