Фумаровая кислота

Арт.: 110178

45 грн.

В наличии

Содержание основного вещества не менее 99%

Квалификация: " Фарм"

Производитель: Китай

Арт. 110178

Описание:

Название продукта

Фумаровая кислота; Fumaric acid

Синонимы

Фумаровая кислота;транс-2-бутендикислоты; trans-2-Butenedioic acid

Молекулярная формула

C4H4O4

Молекулярный вес

116.07

InChI

InChI=1/C4H4O4/c5-3(6)1-2-4(7)8/h1-2H,(H,5,6)(H,7,8)/b2-1+

Регистрационный номер CAS

110-17-8

EINECS

203-743-0

Молекулярная структура

Плотность

1.625

Температура плавления

295-300℃

Температура вспышки

230℃

Растворимость в воде

0.63 g/100 mL (25℃)

Символы опасности

 Xi:Irritant;

Риск коды

R36:;

Характеристики безопасности

S26:;

 

Загрузка...