Нитрометан

Арт.: 75525.1000

1791 грн.

В наличии

Соржание основного вещества не менее 99%

Квалификация: "Для синтеза"

Производитель: импортный

Арт.75525

 

Описание:

 

Название продукта

Nitromethane; Нитрометан

Синонимы

NITROMETHAN 99%; Нитрометан

Молекулярная формула

CH3NO2

Молекулярный вес

61.04

InChI

InChI=1/CH3NO2/c1-2(3)4/h1H3

Регистрационный номер CAS

75-52-5

EINECS

200-876-6

Молекулярная структура

 

Плотность

1.1371

Температура плавления

-29℃

Точка кипения

100-102℃

Показатель преломления

1.3805-1.3825

Температура вспышки

35℃

Растворимость в воде

9.5 g/100 mL (20℃)

Символы опасности

 Xn:Harmful;

Риск коды

R10:;

R22:;

R5:;

 

Характеристики безопасности

S41:;

 

 

Сообщения не найдены

Загрузка...