Ацетофенон

Арт.: 98862.100

239 грн.

В наличии

Соржание основного вещества 98%

Квалификация: "Для синтеза"

Производитель: импортный 

Арт.98862

 

Описание:

Название продукта

Acetophenone, Ацетофенон

Синонимы

Methyl phenyl ketone; 1-Phenylethanone; alpha-Acetophenone;Метил фенил кетон;1-Фенилетанон; альфа-Ацетофенон.

Молекулярная формула

C8H8O

Молекулярный вес

120.15

InChI

InChI=1/C8H8O/c1-7(9)8-5-3-2-4-6-8/h2-6H,1H3

Регистрационный номер CAS

98-86-2

EINECS

202-708-7

Молекулярная структура

 

 

Плотность

1.0266

Температура плавления

19.6℃

Точка кипения

202℃

Показатель преломления

1.5315-1.534

Температура вспышки

77℃

Растворимость в воде

5.5 g/L (20℃)

Символы опасности

 Xn:Harmful;

Риск коды

R22:;

R36:;

 

Характеристики безопасности

S26:;

 

 

Сообщения не найдены

Загрузка...